About ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde
ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde (PubChem CID 143679518) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde.
Molecular Properties
| Compound Name | ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde |
| PubChem CID | 143679518 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde |
| SMILES | C=C(NC)C(=O)O.CC.Cc1ccccc1C=O |
| InChI | InChI=1S/C8H8O.C4H7NO2.C2H6/c1-7-4-2-3-5-8(7)6-9;1-3(5-2)4(6)7;1-2/h2-6H,1H3;5H,1H2,2H3,(H,6,7);1-2H3 |
| InChIKey | VKKHUNDCHVLKPD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde?
The IUPAC name of ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde (CID 143679518) is ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde.
What is the SMILES notation for ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde?
The canonical SMILES for ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde is C=C(NC)C(=O)O.CC.Cc1ccccc1C=O.
What is the InChIKey of ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde?
The InChIKey is VKKHUNDCHVLKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H7NO2.C2H6/c1-7-4-2-3-5-8(7)6-9;1-3(5-2)4(6)7;1-2/h2-6H,1H3;5H,1H2,2H3,(H,6,7);1-2H3.
What are the key properties of ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde?
ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde has a molecular weight of 251.33 g/mol, XLogP of 2.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(methylamino)prop-2-enoic acid;2-methylbenzaldehyde is sourced from PubChem (CID 143679518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).