About ethanol;2-methylbenzaldehyde
ethanol;2-methylbenzaldehyde (PubChem CID 161286186) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is ethanol;2-methylbenzaldehyde.
Molecular Properties
| Compound Name | ethanol;2-methylbenzaldehyde |
| PubChem CID | 161286186 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | ethanol;2-methylbenzaldehyde |
| SMILES | CCO.Cc1ccccc1C=O |
| InChI | InChI=1S/C8H8O.C2H6O/c1-7-4-2-3-5-8(7)6-9;1-2-3/h2-6H,1H3;3H,2H2,1H3 |
| InChIKey | VFTDTRAGNGOMBD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-methylbenzaldehyde?
The IUPAC name of ethanol;2-methylbenzaldehyde (CID 161286186) is ethanol;2-methylbenzaldehyde.
What is the SMILES notation for ethanol;2-methylbenzaldehyde?
The canonical SMILES for ethanol;2-methylbenzaldehyde is CCO.Cc1ccccc1C=O.
What is the InChIKey of ethanol;2-methylbenzaldehyde?
The InChIKey is VFTDTRAGNGOMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H6O/c1-7-4-2-3-5-8(7)6-9;1-2-3/h2-6H,1H3;3H,2H2,1H3.
What are the key properties of ethanol;2-methylbenzaldehyde?
ethanol;2-methylbenzaldehyde has a molecular weight of 166.22 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-methylbenzaldehyde is sourced from PubChem (CID 161286186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).