C17H21N5OS — CID 143159954
14-(dimethylamino)-5-piperidin-4-yl-8-thia-3,5,10-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,9,11-pentaen-6-one (PubChem CID 143159954) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is 14-(dimethylamino)-5-piperidin-4-yl-8-thia-3,5,10-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,9,11-pentaen-6-one.
| Compound Name | 14-(dimethylamino)-5-piperidin-4-yl-8-thia-3,5,10-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143159954 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 14-(dimethylamino)-5-piperidin-4-yl-8-thia-3,5,10-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,9,11-pentaen-6-one |
| SMILES | CN(C)C1=c2c(sc3c(=O)n(C4CCNCC4)cnc23)=NC=CC1 |
| InChI | InChI=1S/C17H21N5OS/c1-21(2)12-4-3-7-19-16-13(12)14-15(24-16)17(23)22(10-20-14)11-5-8-18-9-6-11/h3,7,10-11,18H,4-6,8-9H2,1-2H3 |
| InChIKey | UPGUTCDTFVKUCE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |