C13H24N2 — CID 143159959
N'-methyl-N-[(3E)-undeca-3,10-dien-3-yl]methanimidamide (PubChem CID 143159959) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-methyl-N-[(3E)-undeca-3,10-dien-3-yl]methanimidamide.
| Compound Name | N'-methyl-N-[(3E)-undeca-3,10-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 143159959 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-methyl-N-[(3E)-undeca-3,10-dien-3-yl]methanimidamide |
| SMILES | C=CCCCCC/C=C(\CC)N/C=N/C |
| InChI | InChI=1S/C13H24N2/c1-4-6-7-8-9-10-11-13(5-2)15-12-14-3/h4,11-12H,1,5-10H2,2-3H3,(H,14,15)/b13-11+ |
| InChIKey | NAMOYASDNYVWBK-ACCUITESSA-N |
| XLogP | 3.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|