C19H22LiNO2S — CID 143161525
lithium [(2R)-1-hydroxy-3-phenylpropan-2-yl]-(2-methyl-2-phenylsulfanylpropanoyl)azanide (PubChem CID 143161525) has the molecular formula C19H22LiNO2S and a molecular weight of 335.40 g/mol. Its IUPAC name is lithium [(2R)-1-hydroxy-3-phenylpropan-2-yl]-(2-methyl-2-phenylsulfanylpropanoyl)azanide.
| Compound Name | lithium [(2R)-1-hydroxy-3-phenylpropan-2-yl]-(2-methyl-2-phenylsulfanylpropanoyl)azanide |
|---|---|
| PubChem CID | 143161525 |
| Molecular Formula | C19H22LiNO2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | lithium [(2R)-1-hydroxy-3-phenylpropan-2-yl]-(2-methyl-2-phenylsulfanylpropanoyl)azanide |
| SMILES | CC(C)(Sc1ccccc1)C(=O)[N-][C@@H](CO)Cc1ccccc1.[Li+] |
| InChI | InChI=1S/C19H23NO2S.Li/c1-19(2,23-17-11-7-4-8-12-17)18(22)20-16(14-21)13-15-9-5-3-6-10-15;/h3-12,16,21H,13-14H2,1-2H3,(H,20,22);/q;+1/p-1/t16-;/m1./s1 |
| InChIKey | SIVGWMMACLYNBB-PKLMIRHRSA-M |
| XLogP | 1.07 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |