C22H26ClN3O3S4 — CID 143162894
tert-butyl 4-[2-[(2-chloropyridine-4-carbonyl)amino]-3,4,5,6-tetrakis(sulfanyl)phenyl]piperidine-1-carboxylate (PubChem CID 143162894) has the molecular formula C22H26ClN3O3S4 and a molecular weight of 544.19 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2-chloropyridine-4-carbonyl)amino]-3,4,5,6-tetrakis(sulfanyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2-chloropyridine-4-carbonyl)amino]-3,4,5,6-tetrakis(sulfanyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143162894 |
| Molecular Formula | C22H26ClN3O3S4 |
| Molecular Weight | 544.19 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | tert-butyl 4-[2-[(2-chloropyridine-4-carbonyl)amino]-3,4,5,6-tetrakis(sulfanyl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2c(S)c(S)c(S)c(S)c2NC(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H26ClN3O3S4/c1-22(2,3)29-21(28)26-8-5-11(6-9-26)14-15(17(31)19(33)18(32)16(14)30)25-20(27)12-4-7-24-13(23)10-12/h4,7,10-11,30-33H,5-6,8-9H2,1-3H3,(H,25,27) |
| InChIKey | PCIPGDILTSRDJH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.19 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|