C19H29N3O2S — CID 143163396
N-methylcyclohexanamine;3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole-5-carbaldehyde (PubChem CID 143163396) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-methylcyclohexanamine;3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole-5-carbaldehyde.
| Compound Name | N-methylcyclohexanamine;3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 143163396 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-methylcyclohexanamine;3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole-5-carbaldehyde |
| SMILES | CNC1CCCCC1.Cc1nn(C2CCOCC2)c2sc(C=O)cc12 |
| InChI | InChI=1S/C12H14N2O2S.C7H15N/c1-8-11-6-10(7-15)17-12(11)14(13-8)9-2-4-16-5-3-9;1-8-7-5-3-2-4-6-7/h6-7,9H,2-5H2,1H3;7-8H,2-6H2,1H3 |
| InChIKey | IFBJLJUFHJUABN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|