C11H14N2OS — CID 141129709
3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole (PubChem CID 141129709) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole.
| Compound Name | 3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole |
|---|---|
| PubChem CID | 141129709 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-methyl-1-(oxan-4-yl)thieno[3,2-d]pyrazole |
| SMILES | Cc1nn(C2CCOCC2)c2sccc12 |
| InChI | InChI=1S/C11H14N2OS/c1-8-10-4-7-15-11(10)13(12-8)9-2-5-14-6-3-9/h4,7,9H,2-3,5-6H2,1H3 |
| InChIKey | JNDWTKUJSUMXHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |