3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid

C12H15N3O3S — CID 165450130

IUPAC3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid
SMILESCc1nn(C2CCOCC2)c2ncc(S(=O)O)cc12
InChIInChI=1S/C12H15N3O3S/c1-8-11-6-10(19(16)17)7-13-12(11)15(14-8)9-2-4-18-5-3-9/h6-7,9H,2-5H2,1H3,(H,16,17)
InChIKeyPHSJCXHZVNCKIL-UHFFFAOYSA-N
MW281.34 g/mol
LogP1.67
Rot. Bonds2

About 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid

3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid (PubChem CID 165450130) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid.

Molecular Properties

Compound Name3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid
PubChem CID165450130
Molecular FormulaC12H15N3O3S
Molecular Weight281.34 g/mol
Exact Mass281.08
IUPAC Name3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid
SMILESCc1nn(C2CCOCC2)c2ncc(S(=O)O)cc12
InChIInChI=1S/C12H15N3O3S/c1-8-11-6-10(19(16)17)7-13-12(11)15(14-8)9-2-4-18-5-3-9/h6-7,9H,2-5H2,1H3,(H,16,17)
InChIKeyPHSJCXHZVNCKIL-UHFFFAOYSA-N
XLogP1.67
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.34
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid?
The IUPAC name of 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid (CID 165450130) is 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid.
What is the SMILES notation for 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid?
The canonical SMILES for 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid is Cc1nn(C2CCOCC2)c2ncc(S(=O)O)cc12.
What is the InChIKey of 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid?
The InChIKey is PHSJCXHZVNCKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3S/c1-8-11-6-10(19(16)17)7-13-12(11)15(14-8)9-2-4-18-5-3-9/h6-7,9H,2-5H2,1H3,(H,16,17).
What are the key properties of 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid?
3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid has a molecular weight of 281.34 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid is sourced from PubChem (CID 165450130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).