C12H15N3O3S — CID 165450130
3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid (PubChem CID 165450130) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid.
| Compound Name | 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid |
|---|---|
| PubChem CID | 165450130 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-methyl-1-(oxan-4-yl)pyrazolo[5,4-b]pyridine-5-sulfinic acid |
| SMILES | Cc1nn(C2CCOCC2)c2ncc(S(=O)O)cc12 |
| InChI | InChI=1S/C12H15N3O3S/c1-8-11-6-10(19(16)17)7-13-12(11)15(14-8)9-2-4-18-5-3-9/h6-7,9H,2-5H2,1H3,(H,16,17) |
| InChIKey | PHSJCXHZVNCKIL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|