C18H26FNO2 — CID 143163536
1-[2-(4-fluoro-2-methylphenyl)piperidin-1-yl]-4-hydroxy-4-methylpentan-1-one (PubChem CID 143163536) has the molecular formula C18H26FNO2 and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-[2-(4-fluoro-2-methylphenyl)piperidin-1-yl]-4-hydroxy-4-methylpentan-1-one.
| Compound Name | 1-[2-(4-fluoro-2-methylphenyl)piperidin-1-yl]-4-hydroxy-4-methylpentan-1-one |
|---|---|
| PubChem CID | 143163536 |
| Molecular Formula | C18H26FNO2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-[2-(4-fluoro-2-methylphenyl)piperidin-1-yl]-4-hydroxy-4-methylpentan-1-one |
| SMILES | Cc1cc(F)ccc1C1CCCCN1C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C18H26FNO2/c1-13-12-14(19)7-8-15(13)16-6-4-5-11-20(16)17(21)9-10-18(2,3)22/h7-8,12,16,22H,4-6,9-11H2,1-3H3 |
| InChIKey | ZIGALYWAFCEMQE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |