C23H18F2N4O2S — CID 143163642
2-(4-fluorophenyl)-N-[[3-fluoro-4-(6H-pyrido[1,2-b]pyridazin-4-yloxy)phenyl]carbamothioyl]acetamide (PubChem CID 143163642) has the molecular formula C23H18F2N4O2S and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[[3-fluoro-4-(6H-pyrido[1,2-b]pyridazin-4-yloxy)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[[3-fluoro-4-(6H-pyrido[1,2-b]pyridazin-4-yloxy)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 143163642 |
| Molecular Formula | C23H18F2N4O2S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[[3-fluoro-4-(6H-pyrido[1,2-b]pyridazin-4-yloxy)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NC(=S)Nc1ccc(OC2=CC=NN3C=CCC=C23)c(F)c1 |
| InChI | InChI=1S/C23H18F2N4O2S/c24-16-6-4-15(5-7-16)13-22(30)28-23(32)27-17-8-9-20(18(25)14-17)31-21-10-11-26-29-12-2-1-3-19(21)29/h2-12,14H,1,13H2,(H2,27,28,30,32) |
| InChIKey | XYIRQNJQLQTHRA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|