C9H10N2O — CID 143167493
2-methyl-3,4a-dihydro-2H-quinazolin-4-one (PubChem CID 143167493) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-methyl-3,4a-dihydro-2H-quinazolin-4-one.
| Compound Name | 2-methyl-3,4a-dihydro-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 143167493 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-methyl-3,4a-dihydro-2H-quinazolin-4-one |
| SMILES | CC1N=C2C=CC=CC2C(=O)N1 |
| InChI | InChI=1S/C9H10N2O/c1-6-10-8-5-3-2-4-7(8)9(12)11-6/h2-7H,1H3,(H,11,12) |
| InChIKey | PPAHVVOBBDDQBM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |