C11H14N2 — CID 143169040
2,6,8-trimethyl-2H-pyrido[1,2-a]pyrimidine (PubChem CID 143169040) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,6,8-trimethyl-2H-pyrido[1,2-a]pyrimidine.
| Compound Name | 2,6,8-trimethyl-2H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 143169040 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,6,8-trimethyl-2H-pyrido[1,2-a]pyrimidine |
| SMILES | CC1=CC2=NC(C)C=CN2C(C)=C1 |
| InChI | InChI=1S/C11H14N2/c1-8-6-10(3)13-5-4-9(2)12-11(13)7-8/h4-7,9H,1-3H3 |
| InChIKey | CRSKOPUWOWOETE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |