C20H19FN4O — CID 143171765
ethane;3-fluoro-4-[(6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline (PubChem CID 143171765) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is ethane;3-fluoro-4-[(6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline.
| Compound Name | ethane;3-fluoro-4-[(6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline |
|---|---|
| PubChem CID | 143171765 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethane;3-fluoro-4-[(6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline |
| SMILES | CC.Nc1ccc(Oc2ncnc3cc(-c4ccccc4)[nH]c23)c(F)c1 |
| InChI | InChI=1S/C18H13FN4O.C2H6/c19-13-8-12(20)6-7-16(13)24-18-17-15(21-10-22-18)9-14(23-17)11-4-2-1-3-5-11;1-2/h1-10,23H,20H2;1-2H3 |
| InChIKey | DYQOFVURUMKUFA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|