C18H13ClN4O — CID 95929512
4-[(2-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline (PubChem CID 95929512) has the molecular formula C18H13ClN4O and a molecular weight of 336.78 g/mol. Its IUPAC name is 4-[(2-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline.
| Compound Name | 4-[(2-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline |
|---|---|
| PubChem CID | 95929512 |
| Molecular Formula | C18H13ClN4O |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-[(2-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)oxy]aniline |
| SMILES | Nc1ccc(Oc2nc(Cl)nc3cc(-c4ccccc4)[nH]c23)cc1 |
| InChI | InChI=1S/C18H13ClN4O/c19-18-22-15-10-14(11-4-2-1-3-5-11)21-16(15)17(23-18)24-13-8-6-12(20)7-9-13/h1-10,21H,20H2 |
| InChIKey | PPMCXSYFFDVLCS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|