C24H34N4O2 — CID 143172457
ethane;(E)-2-[(Z)-1-[4-[(1-methylindol-3-yl)methylamino]piperidin-1-yl]ethenyliminomethyl]but-2-enoic acid (PubChem CID 143172457) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is ethane;(E)-2-[(Z)-1-[4-[(1-methylindol-3-yl)methylamino]piperidin-1-yl]ethenyliminomethyl]but-2-enoic acid.
| Compound Name | ethane;(E)-2-[(Z)-1-[4-[(1-methylindol-3-yl)methylamino]piperidin-1-yl]ethenyliminomethyl]but-2-enoic acid |
|---|---|
| PubChem CID | 143172457 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | ethane;(E)-2-[(Z)-1-[4-[(1-methylindol-3-yl)methylamino]piperidin-1-yl]ethenyliminomethyl]but-2-enoic acid |
| SMILES | C=C(/N=C\C(=C/C)C(=O)O)N1CCC(NCc2cn(C)c3ccccc23)CC1.CC |
| InChI | InChI=1S/C22H28N4O2.C2H6/c1-4-17(22(27)28)13-23-16(2)26-11-9-19(10-12-26)24-14-18-15-25(3)21-8-6-5-7-20(18)21;1-2/h4-8,13,15,19,24H,2,9-12,14H2,1,3H3,(H,27,28);1-2H3/b17-4+,23-13-; |
| InChIKey | DOSRAJSTSDWGEF-FYKHCNCSSA-N |
| XLogP | 4.33 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|