C24H33N5O3 — CID 143172514
(E)-N-hydroxy-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enamide (PubChem CID 143172514) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is (E)-N-hydroxy-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enamide.
| Compound Name | (E)-N-hydroxy-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enamide |
|---|---|
| PubChem CID | 143172514 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (E)-N-hydroxy-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enamide |
| SMILES | C=C(/N=C\C(=C/C)C(=O)NO)N1CCC(CNCc2cn(C)c3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C24H33N5O3/c1-5-19(24(30)27-31)15-26-17(2)29-10-8-18(9-11-29)13-25-14-20-16-28(3)23-7-6-21(32-4)12-22(20)23/h5-7,12,15-16,18,25,31H,2,8-11,13-14H2,1,3-4H3,(H,27,30)/b19-5+,26-15- |
| InChIKey | MHMFDIUJDNSPKC-AFRKLOQNSA-N |
| XLogP | 2.98 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|