C26H36N4O3 — CID 143172447
ethyl (E)-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enoate (PubChem CID 143172447) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is ethyl (E)-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enoate.
| Compound Name | ethyl (E)-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enoate |
|---|---|
| PubChem CID | 143172447 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | ethyl (E)-2-[(Z)-1-[4-[[(5-methoxy-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]ethenyliminomethyl]but-2-enoate |
| SMILES | C=C(/N=C\C(=C/C)C(=O)OCC)N1CCC(CNCc2cn(C)c3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C26H36N4O3/c1-6-21(26(31)33-7-2)17-28-19(3)30-12-10-20(11-13-30)15-27-16-22-18-29(4)25-9-8-23(32-5)14-24(22)25/h6,8-9,14,17-18,20,27H,3,7,10-13,15-16H2,1-2,4-5H3/b21-6+,28-17- |
| InChIKey | VTZJCGLTHOXOCD-WRNCPTRUSA-N |
| XLogP | 4.04 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|