C15H17N5O4S2 — CID 110371573
N-[5-[(5-methoxy-1-methylindol-3-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110371573) has the molecular formula C15H17N5O4S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-[5-[(5-methoxy-1-methylindol-3-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(5-methoxy-1-methylindol-3-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110371573 |
| Molecular Formula | C15H17N5O4S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-[5-[(5-methoxy-1-methylindol-3-yl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc2c(c1)c(CNS(=O)(=O)c1nnc(NC(C)=O)s1)cn2C |
| InChI | InChI=1S/C15H17N5O4S2/c1-9(21)17-14-18-19-15(25-14)26(22,23)16-7-10-8-20(2)13-5-4-11(24-3)6-12(10)13/h4-6,8,16H,7H2,1-3H3,(H,17,18,21) |
| InChIKey | ZKRSOZUBABQLEJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|