C28H27O4S+ — CID 143174606
[4-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]phenyl]phenyl]oxidanium (PubChem CID 143174606) has the molecular formula C28H27O4S+ and a molecular weight of 459.59 g/mol. Its IUPAC name is [4-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]phenyl]phenyl]oxidanium.
| Compound Name | [4-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]phenyl]phenyl]oxidanium |
|---|---|
| PubChem CID | 143174606 |
| Molecular Formula | C28H27O4S+ |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [4-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]phenyl]phenyl]oxidanium |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)c2ccc(Oc3ccc(-c4ccc([OH2+])cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26O4S/c1-28(2,3)22-8-16-26(17-9-22)33(30,31)27-18-14-25(15-19-27)32-24-12-6-21(7-13-24)20-4-10-23(29)11-5-20/h4-19,29H,1-3H3/p+1 |
| InChIKey | YLANBWRNSAMASR-UHFFFAOYSA-O |
| XLogP | 6.71 |
| TPSA | 66.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|