C33H40F2N2O2 — CID 143175261
1-[5-(3,5-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one;3-ethylpiperidine (PubChem CID 143175261) has the molecular formula C33H40F2N2O2 and a molecular weight of 534.69 g/mol. Its IUPAC name is 1-[5-(3,5-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one;3-ethylpiperidine.
| Compound Name | 1-[5-(3,5-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one;3-ethylpiperidine |
|---|---|
| PubChem CID | 143175261 |
| Molecular Formula | C33H40F2N2O2 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 1-[5-(3,5-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one;3-ethylpiperidine |
| SMILES | CCC1CCCNC1.CCCCC(=O)c1cc(-c2cc(F)cc(F)c2)ccc1/N=C(\C)c1ccccc1OC |
| InChI | InChI=1S/C26H25F2NO2.C7H15N/c1-4-5-9-25(30)23-15-18(19-13-20(27)16-21(28)14-19)11-12-24(23)29-17(2)22-8-6-7-10-26(22)31-3;1-2-7-4-3-5-8-6-7/h6-8,10-16H,4-5,9H2,1-3H3;7-8H,2-6H2,1H3/b29-17+; |
| InChIKey | DRISFYPBGGYIOW-WDCVSKPTSA-N |
| XLogP | 8.55 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|