C30H36F6N3OP — CID 143175683
1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine (PubChem CID 143175683) has the molecular formula C30H36F6N3OP and a molecular weight of 599.60 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 143175683 |
| Molecular Formula | C30H36F6N3OP |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine |
| SMILES | CC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[H]/N=C(CN(CCC)CC(C)Cc1c[nH]c2ccccc12)\C(CC)=P\[H] |
| InChI | InChI=1S/C20H30N3P.C10H6F6O/c1-4-10-23(14-18(21)20(24)5-2)13-15(3)11-16-12-22-19-9-7-6-8-17(16)19;1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h6-9,12,15,21-22,24H,4-5,10-11,13-14H2,1-3H3;2-4H,1H3/b21-18-; |
| InChIKey | FROLTSSNDSBDJR-WIPIHYDQSA-N |
| XLogP | 8.73 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|