C36H50F6N3O2P — CID 143175681
1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine;1-propoxypropane (PubChem CID 143175681) has the molecular formula C36H50F6N3O2P and a molecular weight of 701.78 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine;1-propoxypropane.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine;1-propoxypropane |
|---|---|
| PubChem CID | 143175681 |
| Molecular Formula | C36H50F6N3O2P |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 701.35 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanone;2-imino-N-[3-(1H-indol-3-yl)-2-methylpropyl]-3-phosphanylidene-N-propylpentan-1-amine;1-propoxypropane |
| SMILES | CC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.CCCOCCC.[H]/N=C(CN(CCC)CC(C)Cc1c[nH]c2ccccc12)\C(CC)=P\[H] |
| InChI | InChI=1S/C20H30N3P.C10H6F6O.C6H14O/c1-4-10-23(14-18(21)20(24)5-2)13-15(3)11-16-12-22-19-9-7-6-8-17(16)19;1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16;1-3-5-7-6-4-2/h6-9,12,15,21-22,24H,4-5,10-11,13-14H2,1-3H3;2-4H,1H3;3-6H2,1-2H3/b21-18-;; |
| InChIKey | PBUBRIMELPKDNC-LUUCHEBKSA-N |
| XLogP | 10.55 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|