C18H24N4O2 — CID 143175975
(3E)-3-[(3,4-dimethylphenyl)hydrazinylidene]-N-phenylbutanamide;hydroxylamine (PubChem CID 143175975) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (3E)-3-[(3,4-dimethylphenyl)hydrazinylidene]-N-phenylbutanamide;hydroxylamine.
| Compound Name | (3E)-3-[(3,4-dimethylphenyl)hydrazinylidene]-N-phenylbutanamide;hydroxylamine |
|---|---|
| PubChem CID | 143175975 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3E)-3-[(3,4-dimethylphenyl)hydrazinylidene]-N-phenylbutanamide;hydroxylamine |
| SMILES | C/C(CC(=O)Nc1ccccc1)=N\Nc1ccc(C)c(C)c1.NO |
| InChI | InChI=1S/C18H21N3O.H3NO/c1-13-9-10-17(11-14(13)2)21-20-15(3)12-18(22)19-16-7-5-4-6-8-16;1-2/h4-11,21H,12H2,1-3H3,(H,19,22);2H,1H2/b20-15+; |
| InChIKey | GKXYQEUTGNJYMI-QMGGKDRNSA-N |
| XLogP | 3.45 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|