C10H16N4 — CID 143176208
N,N'-diamino-N-(2-phenylethyl)ethanimidamide (PubChem CID 143176208) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N,N'-diamino-N-(2-phenylethyl)ethanimidamide.
| Compound Name | N,N'-diamino-N-(2-phenylethyl)ethanimidamide |
|---|---|
| PubChem CID | 143176208 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N,N'-diamino-N-(2-phenylethyl)ethanimidamide |
| SMILES | C/C(=N/N)N(N)CCc1ccccc1 |
| InChI | InChI=1S/C10H16N4/c1-9(13-11)14(12)8-7-10-5-3-2-4-6-10/h2-6H,7-8,11-12H2,1H3/b13-9- |
| InChIKey | QGJSIJVASURJRS-LCYFTJDESA-N |
| XLogP | 0.70 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|