C12H19Br2N3 — CID 144642375
(Z)-2-[amino(2-phenylethyl)amino]-1,2-dibromoethenamine;ethane (PubChem CID 144642375) has the molecular formula C12H19Br2N3 and a molecular weight of 365.11 g/mol. Its IUPAC name is (Z)-2-[amino(2-phenylethyl)amino]-1,2-dibromoethenamine;ethane.
| Compound Name | (Z)-2-[amino(2-phenylethyl)amino]-1,2-dibromoethenamine;ethane |
|---|---|
| PubChem CID | 144642375 |
| Molecular Formula | C12H19Br2N3 |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (Z)-2-[amino(2-phenylethyl)amino]-1,2-dibromoethenamine;ethane |
| SMILES | CC.N/C(Br)=C(/Br)N(N)CCc1ccccc1 |
| InChI | InChI=1S/C10H13Br2N3.C2H6/c11-9(13)10(12)15(14)7-6-8-4-2-1-3-5-8;1-2/h1-5H,6-7,13-14H2;1-2H3/b10-9-; |
| InChIKey | PGKHWVQAOURGHU-KVVVOXFISA-N |
| XLogP | 3.31 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|