About [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone
[4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone (PubChem CID 143176326) has the molecular formula C16H21F2N3O2
and a molecular weight of 325.36 g/mol. Its IUPAC name is [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone.
Molecular Properties
| Compound Name | [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone |
| PubChem CID | 143176326 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(N1CCNCC1)N1CCC(Oc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H21F2N3O2/c17-14-2-1-13(11-15(14)18)23-12-3-7-20(8-4-12)16(22)21-9-5-19-6-10-21/h1-2,11-12,19H,3-10H2 |
| InChIKey | SOAIYNBBXATLBG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone?
The IUPAC name of [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone (CID 143176326) is [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone.
What is the SMILES notation for [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone?
The canonical SMILES for [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone is O=C(N1CCNCC1)N1CCC(Oc2ccc(F)c(F)c2)CC1.
What is the InChIKey of [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone?
The InChIKey is SOAIYNBBXATLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2N3O2/c17-14-2-1-13(11-15(14)18)23-12-3-7-20(8-4-12)16(22)21-9-5-19-6-10-21/h1-2,11-12,19H,3-10H2.
What are the key properties of [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone?
[4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone has a molecular weight of 325.36 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-difluorophenoxy)piperidin-1-yl]-piperazin-1-ylmethanone is sourced from PubChem (CID 143176326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).