C28H33N5O2 — CID 143178777
2-amino-5-[3-[(2E,4Z,6E)-7-methoxyhepta-2,4,6-trien-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-N-(1-methylpyrrolidin-3-yl)benzamide (PubChem CID 143178777) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-amino-5-[3-[(2E,4Z,6E)-7-methoxyhepta-2,4,6-trien-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-N-(1-methylpyrrolidin-3-yl)benzamide.
| Compound Name | 2-amino-5-[3-[(2E,4Z,6E)-7-methoxyhepta-2,4,6-trien-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-N-(1-methylpyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 143178777 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-amino-5-[3-[(2E,4Z,6E)-7-methoxyhepta-2,4,6-trien-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-N-(1-methylpyrrolidin-3-yl)benzamide |
| SMILES | CO/C=C/C=C\C=C(/C)c1c[nH]c2ncc(-c3ccc(N)c(C(=O)N(C)C4CCN(C)C4)c3)cc12 |
| InChI | InChI=1S/C28H33N5O2/c1-19(8-6-5-7-13-35-4)25-17-31-27-23(25)15-21(16-30-27)20-9-10-26(29)24(14-20)28(34)33(3)22-11-12-32(2)18-22/h5-10,13-17,22H,11-12,18,29H2,1-4H3,(H,30,31)/b6-5-,13-7+,19-8+ |
| InChIKey | DMPLDOCDMQHHEN-PCSPZHJRSA-N |
| XLogP | 4.71 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|