C13H12F2N2O3 — CID 14317897
3-ethoxycarbonyl-2-ethyl-6,7-difluorocinnolin-2-ium-4-olate (PubChem CID 14317897) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-ethoxycarbonyl-2-ethyl-6,7-difluorocinnolin-2-ium-4-olate.
| Compound Name | 3-ethoxycarbonyl-2-ethyl-6,7-difluorocinnolin-2-ium-4-olate |
|---|---|
| PubChem CID | 14317897 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-ethoxycarbonyl-2-ethyl-6,7-difluorocinnolin-2-ium-4-olate |
| SMILES | CCOC(=O)c1c([O-])c2cc(F)c(F)cc2n[n+]1CC |
| InChI | InChI=1S/C13H12F2N2O3/c1-3-17-11(13(19)20-4-2)12(18)7-5-8(14)9(15)6-10(7)16-17/h5-6H,3-4H2,1-2H3 |
| InChIKey | HCXOJPFIYBNLGT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|