C12H9F3N2O3 — CID 14317890
3-ethoxycarbonyl-6,7,8-trifluoro-2-methylcinnolin-2-ium-4-olate (PubChem CID 14317890) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 3-ethoxycarbonyl-6,7,8-trifluoro-2-methylcinnolin-2-ium-4-olate.
| Compound Name | 3-ethoxycarbonyl-6,7,8-trifluoro-2-methylcinnolin-2-ium-4-olate |
|---|---|
| PubChem CID | 14317890 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-ethoxycarbonyl-6,7,8-trifluoro-2-methylcinnolin-2-ium-4-olate |
| SMILES | CCOC(=O)c1c([O-])c2cc(F)c(F)c(F)c2n[n+]1C |
| InChI | InChI=1S/C12H9F3N2O3/c1-3-20-12(19)10-11(18)5-4-6(13)7(14)8(15)9(5)16-17(10)2/h4H,3H2,1-2H3 |
| InChIKey | BTUVQEKGDNFXQK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|