C12H10F3N2O3+ — CID 14317891
ethyl 6,7,8-trifluoro-2-methyl-4-oxo-1H-cinnolin-2-ium-3-carboxylate (PubChem CID 14317891) has the molecular formula C12H10F3N2O3+ and a molecular weight of 287.22 g/mol. Its IUPAC name is ethyl 6,7,8-trifluoro-2-methyl-4-oxo-1H-cinnolin-2-ium-3-carboxylate.
| Compound Name | ethyl 6,7,8-trifluoro-2-methyl-4-oxo-1H-cinnolin-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 14317891 |
| Molecular Formula | C12H10F3N2O3+ |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | ethyl 6,7,8-trifluoro-2-methyl-4-oxo-1H-cinnolin-2-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2cc(F)c(F)c(F)c2[nH][n+]1C |
| InChI | InChI=1S/C12H9F3N2O3/c1-3-20-12(19)10-11(18)5-4-6(13)7(14)8(15)9(5)16-17(10)2/h4H,3H2,1-2H3/p+1 |
| InChIKey | BTUVQEKGDNFXQK-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|