C21H18F3NO2S — CID 25094102
ethyl 6,7,8-trifluoro-4-(4-propan-2-ylphenyl)sulfanylquinoline-3-carboxylate (PubChem CID 25094102) has the molecular formula C21H18F3NO2S and a molecular weight of 405.44 g/mol. Its IUPAC name is ethyl 6,7,8-trifluoro-4-(4-propan-2-ylphenyl)sulfanylquinoline-3-carboxylate.
| Compound Name | ethyl 6,7,8-trifluoro-4-(4-propan-2-ylphenyl)sulfanylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 25094102 |
| Molecular Formula | C21H18F3NO2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | ethyl 6,7,8-trifluoro-4-(4-propan-2-ylphenyl)sulfanylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(F)c(F)c(F)cc2c1Sc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H18F3NO2S/c1-4-27-21(26)15-10-25-19-14(9-16(22)17(23)18(19)24)20(15)28-13-7-5-12(6-8-13)11(2)3/h5-11H,4H2,1-3H3 |
| InChIKey | AYDZGTOAWGIRJG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|