C20H13F6NO2S — CID 54568173
ethyl 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfanylquinoline-3-carboxylate (PubChem CID 54568173) has the molecular formula C20H13F6NO2S and a molecular weight of 445.38 g/mol. Its IUPAC name is ethyl 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfanylquinoline-3-carboxylate.
| Compound Name | ethyl 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfanylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 54568173 |
| Molecular Formula | C20H13F6NO2S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | ethyl 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfanylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C(F)(F)F)cc2c1Sc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F6NO2S/c1-2-29-18(28)15-10-27-16-7-6-12(20(24,25)26)9-14(16)17(15)30-13-5-3-4-11(8-13)19(21,22)23/h3-10H,2H2,1H3 |
| InChIKey | ZVIFXBQCTIAXLA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |