C22H40 — CID 143180238
3,3-dimethylhexane;1-heptyl-4-methylbenzene (PubChem CID 143180238) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 3,3-dimethylhexane;1-heptyl-4-methylbenzene.
| Compound Name | 3,3-dimethylhexane;1-heptyl-4-methylbenzene |
|---|---|
| PubChem CID | 143180238 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 3,3-dimethylhexane;1-heptyl-4-methylbenzene |
| SMILES | CCCC(C)(C)CC.CCCCCCCc1ccc(C)cc1 |
| InChI | InChI=1S/C14H22.C8H18/c1-3-4-5-6-7-8-14-11-9-13(2)10-12-14;1-5-7-8(3,4)6-2/h9-12H,3-8H2,1-2H3;5-7H2,1-4H3 |
| InChIKey | QORDBKQLGRIDCG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|