C17H25N5O — CID 143180996
N'-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]butane-1,4-diamine (PubChem CID 143180996) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is N'-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]butane-1,4-diamine.
| Compound Name | N'-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 143180996 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | N'-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]butane-1,4-diamine |
| SMILES | COc1ccc2nccc(N3CCC(NCCCCN)C3)c2n1 |
| InChI | InChI=1S/C17H25N5O/c1-23-16-5-4-14-17(21-16)15(6-10-20-14)22-11-7-13(12-22)19-9-3-2-8-18/h4-6,10,13,19H,2-3,7-9,11-12,18H2,1H3 |
| InChIKey | VHNWZZPONVTUSM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|