About [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine
[1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine (PubChem CID 66953692) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine |
| PubChem CID | 66953692 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine |
| SMILES | COc1ccc2nccc(N3CC(CN)C3)c2n1 |
| InChI | InChI=1S/C13H16N4O/c1-18-12-3-2-10-13(16-12)11(4-5-15-10)17-7-9(6-14)8-17/h2-5,9H,6-8,14H2,1H3 |
| InChIKey | YBWRYIVELUSCDL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine?
The IUPAC name of [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine (CID 66953692) is [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine.
What is the SMILES notation for [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine?
The canonical SMILES for [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine is COc1ccc2nccc(N3CC(CN)C3)c2n1.
What is the InChIKey of [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine?
The InChIKey is YBWRYIVELUSCDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-18-12-3-2-10-13(16-12)11(4-5-15-10)17-7-9(6-14)8-17/h2-5,9H,6-8,14H2,1H3.
What are the key properties of [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine?
[1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine has a molecular weight of 244.30 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-methoxy-1,5-naphthyridin-4-yl)azetidin-3-yl]methanamine is sourced from PubChem (CID 66953692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).