C29H43Br2ClN4O2 — CID 143181022
(5S,6Z)-4-bromo-2-chloro-5,7-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene;2-bromoethanimine;4-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboxamide (PubChem CID 143181022) has the molecular formula C29H43Br2ClN4O2 and a molecular weight of 674.95 g/mol. Its IUPAC name is (5S,6Z)-4-bromo-2-chloro-5,7-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene;2-bromoethanimine;4-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboxamide.
| Compound Name | (5S,6Z)-4-bromo-2-chloro-5,7-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene;2-bromoethanimine;4-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143181022 |
| Molecular Formula | C29H43Br2ClN4O2 |
| Molecular Weight | 674.95 g/mol |
| Exact Mass | 672.14 |
| IUPAC Name | (5S,6Z)-4-bromo-2-chloro-5,7-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene;2-bromoethanimine;4-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboxamide |
| SMILES | C/C1=C/[C@H](C)c2c(Br)cc(Cl)cc2CCC1.NC(=O)N1CCC(CC(=O)N2CCCCC2)CC1.[H]/N=C/CBr |
| InChI | InChI=1S/C14H16BrCl.C13H23N3O2.C2H4BrN/c1-9-4-3-5-11-7-12(16)8-13(15)14(11)10(2)6-9;14-13(18)16-8-4-11(5-9-16)10-12(17)15-6-2-1-3-7-15;3-1-2-4/h6-8,10H,3-5H2,1-2H3;11H,1-10H2,(H2,14,18);2,4H,1H2/b9-6-;;4-2+/t10-;;/m0../s1 |
| InChIKey | OIESTIGWIIQWFH-AAAADFNMSA-N |
| XLogP | 7.70 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.95 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|