C33H48Br2N4O3 — CID 142134061
acetylene;4-[2-[4-[(6Z)-4-bromo-7-ethyl-2-hydroxy-5,8,9,10-tetrahydrobenzo[8]annulen-5-yl]piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide;2-bromo-2-methylpropan-1-imine (PubChem CID 142134061) has the molecular formula C33H48Br2N4O3 and a molecular weight of 708.58 g/mol. Its IUPAC name is acetylene;4-[2-[4-[(6Z)-4-bromo-7-ethyl-2-hydroxy-5,8,9,10-tetrahydrobenzo[8]annulen-5-yl]piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide;2-bromo-2-methylpropan-1-imine.
| Compound Name | acetylene;4-[2-[4-[(6Z)-4-bromo-7-ethyl-2-hydroxy-5,8,9,10-tetrahydrobenzo[8]annulen-5-yl]piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide;2-bromo-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 142134061 |
| Molecular Formula | C33H48Br2N4O3 |
| Molecular Weight | 708.58 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | acetylene;4-[2-[4-[(6Z)-4-bromo-7-ethyl-2-hydroxy-5,8,9,10-tetrahydrobenzo[8]annulen-5-yl]piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide;2-bromo-2-methylpropan-1-imine |
| SMILES | C#C.CC/C1=C/C(C2CCN(C(=O)CC3CCN(C(N)=O)CC3)CC2)c2c(Br)cc(O)cc2CCC1.[H]/N=C/C(C)(C)Br |
| InChI | InChI=1S/C27H38BrN3O3.C4H8BrN.C2H2/c1-2-18-4-3-5-21-16-22(32)17-24(28)26(21)23(14-18)20-8-12-30(13-9-20)25(33)15-19-6-10-31(11-7-19)27(29)34;1-4(2,5)3-6;1-2/h14,16-17,19-20,23,32H,2-13,15H2,1H3,(H2,29,34);3,6H,1-2H3;1-2H/b18-14-;6-3+; |
| InChIKey | IPEWNDABTXXCFO-SZEPOASFSA-N |
| XLogP | 7.39 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.58 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|