C13H24N2O — CID 18713027
4-(3,3-dimethyl-2-methylidenebutyl)piperidine-1-carboxamide (PubChem CID 18713027) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-methylidenebutyl)piperidine-1-carboxamide.
| Compound Name | 4-(3,3-dimethyl-2-methylidenebutyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 18713027 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 4-(3,3-dimethyl-2-methylidenebutyl)piperidine-1-carboxamide |
| SMILES | C=C(CC1CCN(C(N)=O)CC1)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O/c1-10(13(2,3)4)9-11-5-7-15(8-6-11)12(14)16/h11H,1,5-9H2,2-4H3,(H2,14,16) |
| InChIKey | PJMWDZYRQDVOAL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|