C15H21N3 — CID 143181782
9,10,13-trimethyl-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5,9-tetraene (PubChem CID 143181782) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 9,10,13-trimethyl-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5,9-tetraene.
| Compound Name | 9,10,13-trimethyl-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 143181782 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 9,10,13-trimethyl-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5,9-tetraene |
| SMILES | CC1=C(C)C2CN(C)CCN2c2ncccc2C1 |
| InChI | InChI=1S/C15H21N3/c1-11-9-13-5-4-6-16-15(13)18-8-7-17(3)10-14(18)12(11)2/h4-6,14H,7-10H2,1-3H3 |
| InChIKey | MDIGWIQYFKFLPJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|