C25H37NO2S — CID 143182434
2-butyl-3,4-dihydro-1H-isoquinoline;ethyl-methylidene-oxo-(4-propan-2-yloxyphenyl)-λ6-sulfane (PubChem CID 143182434) has the molecular formula C25H37NO2S and a molecular weight of 415.64 g/mol. Its IUPAC name is 2-butyl-3,4-dihydro-1H-isoquinoline;ethyl-methylidene-oxo-(4-propan-2-yloxyphenyl)-λ6-sulfane.
| Compound Name | 2-butyl-3,4-dihydro-1H-isoquinoline;ethyl-methylidene-oxo-(4-propan-2-yloxyphenyl)-λ6-sulfane |
|---|---|
| PubChem CID | 143182434 |
| Molecular Formula | C25H37NO2S |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-butyl-3,4-dihydro-1H-isoquinoline;ethyl-methylidene-oxo-(4-propan-2-yloxyphenyl)-λ6-sulfane |
| SMILES | C=S(=O)(CC)c1ccc(OC(C)C)cc1.CCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H19N.C12H18O2S/c1-2-3-9-14-10-8-12-6-4-5-7-13(12)11-14;1-5-15(4,13)12-8-6-11(7-9-12)14-10(2)3/h4-7H,2-3,8-11H2,1H3;6-10H,4-5H2,1-3H3 |
| InChIKey | XRFJLBAVEQMJPX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|