C18H22N2O6 — CID 143182877
5-(2,5-dioxopyrrol-1-yl)pentanal;1-(4-oxopentyl)pyrrole-2,5-dione (PubChem CID 143182877) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)pentanal;1-(4-oxopentyl)pyrrole-2,5-dione.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)pentanal;1-(4-oxopentyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 143182877 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)pentanal;1-(4-oxopentyl)pyrrole-2,5-dione |
| SMILES | CC(=O)CCCN1C(=O)C=CC1=O.O=CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/2C9H11NO3/c1-7(11)3-2-6-10-8(12)4-5-9(10)13;11-7-3-1-2-6-10-8(12)4-5-9(10)13/h4-5H,2-3,6H2,1H3;4-5,7H,1-3,6H2 |
| InChIKey | NKFJZGQTASVLQW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|