C21H24N4OS — CID 143184339
6-[amino(propylsulfanyl)amino]-2-(4-ethoxyphenyl)-1-methylindole-3-carbonitrile (PubChem CID 143184339) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 6-[amino(propylsulfanyl)amino]-2-(4-ethoxyphenyl)-1-methylindole-3-carbonitrile.
| Compound Name | 6-[amino(propylsulfanyl)amino]-2-(4-ethoxyphenyl)-1-methylindole-3-carbonitrile |
|---|---|
| PubChem CID | 143184339 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-[amino(propylsulfanyl)amino]-2-(4-ethoxyphenyl)-1-methylindole-3-carbonitrile |
| SMILES | CCCSN(N)c1ccc2c(C#N)c(-c3ccc(OCC)cc3)n(C)c2c1 |
| InChI | InChI=1S/C21H24N4OS/c1-4-12-27-25(23)16-8-11-18-19(14-22)21(24(3)20(18)13-16)15-6-9-17(10-7-15)26-5-2/h6-11,13H,4-5,12,23H2,1-3H3 |
| InChIKey | MQEVESJNNFDUMH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|