C20H18F3N3O3S — CID 58724749
N-[4-[3-cyano-1-methyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-N-methylethanesulfonamide (PubChem CID 58724749) has the molecular formula C20H18F3N3O3S and a molecular weight of 437.44 g/mol. Its IUPAC name is N-[4-[3-cyano-1-methyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-N-methylethanesulfonamide.
| Compound Name | N-[4-[3-cyano-1-methyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 58724749 |
| Molecular Formula | C20H18F3N3O3S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[4-[3-cyano-1-methyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)c1ccc(-c2c(C#N)c3ccc(OC(F)(F)F)cc3n2C)cc1 |
| InChI | InChI=1S/C20H18F3N3O3S/c1-4-30(27,28)26(3)14-7-5-13(6-8-14)19-17(12-24)16-10-9-15(29-20(21,22)23)11-18(16)25(19)2/h5-11H,4H2,1-3H3 |
| InChIKey | SXCQDWOGKBRBTP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |