C9H15NO — CID 143186298
(3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-amine (PubChem CID 143186298) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143186298 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(N)=C\C(=C/C)OC |
| InChI | InChI=1S/C9H15NO/c1-5-8(11-4)6-9(10)7(2)3/h5-6H,2,10H2,1,3-4H3/b8-5+,9-6+ |
| InChIKey | ONQRJUBOLKSIFK-XVYDYJIPSA-N |
| XLogP | 1.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|