C19H26N6O2 — CID 143189203
2-(4-amino-2-hydroxyanilino)-8-(2,2-dimethylpropyl)-5,7-dimethyl-7H-pteridin-6-one (PubChem CID 143189203) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-(4-amino-2-hydroxyanilino)-8-(2,2-dimethylpropyl)-5,7-dimethyl-7H-pteridin-6-one.
| Compound Name | 2-(4-amino-2-hydroxyanilino)-8-(2,2-dimethylpropyl)-5,7-dimethyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 143189203 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-(4-amino-2-hydroxyanilino)-8-(2,2-dimethylpropyl)-5,7-dimethyl-7H-pteridin-6-one |
| SMILES | CC1C(=O)N(C)c2cnc(Nc3ccc(N)cc3O)nc2N1CC(C)(C)C |
| InChI | InChI=1S/C19H26N6O2/c1-11-17(27)24(5)14-9-21-18(22-13-7-6-12(20)8-15(13)26)23-16(14)25(11)10-19(2,3)4/h6-9,11,26H,10,20H2,1-5H3,(H,21,22,23) |
| InChIKey | POCGZOBZWOQKGA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|