C15H14ClN3O2 — CID 143192070
2-[2-[(2-chloro-4-methylphenyl)methylamino]-3-pyridinyl]-2-iminoacetic acid (PubChem CID 143192070) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-[2-[(2-chloro-4-methylphenyl)methylamino]-3-pyridinyl]-2-iminoacetic acid.
| Compound Name | 2-[2-[(2-chloro-4-methylphenyl)methylamino]-3-pyridinyl]-2-iminoacetic acid |
|---|---|
| PubChem CID | 143192070 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[2-[(2-chloro-4-methylphenyl)methylamino]-3-pyridinyl]-2-iminoacetic acid |
| SMILES | [H]/N=C(\C(=O)O)c1cccnc1NCc1ccc(C)cc1Cl |
| InChI | InChI=1S/C15H14ClN3O2/c1-9-4-5-10(12(16)7-9)8-19-14-11(3-2-6-18-14)13(17)15(20)21/h2-7,17H,8H2,1H3,(H,18,19)(H,20,21)/b17-13- |
| InChIKey | CTRFJDJVXBNFOK-LGMDPLHJSA-N |
| XLogP | 3.11 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|