C12H14N2O2 — CID 143193655
2-hydroxy-10a-methyl-5,10-dihydro-1H-imidazo[1,5-b]isoquinolin-3-one (PubChem CID 143193655) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-hydroxy-10a-methyl-5,10-dihydro-1H-imidazo[1,5-b]isoquinolin-3-one.
| Compound Name | 2-hydroxy-10a-methyl-5,10-dihydro-1H-imidazo[1,5-b]isoquinolin-3-one |
|---|---|
| PubChem CID | 143193655 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-hydroxy-10a-methyl-5,10-dihydro-1H-imidazo[1,5-b]isoquinolin-3-one |
| SMILES | CC12Cc3ccccc3CN1C(=O)N(O)C2 |
| InChI | InChI=1S/C12H14N2O2/c1-12-6-9-4-2-3-5-10(9)7-13(12)11(15)14(16)8-12/h2-5,16H,6-8H2,1H3 |
| InChIKey | MBUZPDBPTMWBCT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|