C10H9FN2O5S — CID 159450830
(8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) hydrogen sulfate (PubChem CID 159450830) has the molecular formula C10H9FN2O5S and a molecular weight of 288.26 g/mol. Its IUPAC name is (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) hydrogen sulfate.
| Compound Name | (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 159450830 |
| Molecular Formula | C10H9FN2O5S |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) hydrogen sulfate |
| SMILES | O=C1N2CC(c3ccccc3C2F)N1OS(=O)(=O)O |
| InChI | InChI=1S/C10H9FN2O5S/c11-9-7-4-2-1-3-6(7)8-5-12(9)10(14)13(8)18-19(15,16)17/h1-4,8-9H,5H2,(H,15,16,17) |
| InChIKey | LTIVFFNRQRHQMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|