About 1-methylbenzo[h]isoquinoline;1-methylindazole
1-methylbenzo[h]isoquinoline;1-methylindazole (PubChem CID 143194474) has the molecular formula C22H19N3
and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-methylbenzo[h]isoquinoline;1-methylindazole.
Molecular Properties
| Compound Name | 1-methylbenzo[h]isoquinoline;1-methylindazole |
| PubChem CID | 143194474 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-methylbenzo[h]isoquinoline;1-methylindazole |
| SMILES | Cc1nccc2ccc3ccccc3c12.Cn1ncc2ccccc21 |
| InChI | InChI=1S/C14H11N.C8H8N2/c1-10-14-12(8-9-15-10)7-6-11-4-2-3-5-13(11)14;1-10-8-5-3-2-4-7(8)6-9-10/h2-9H,1H3;2-6H,1H3 |
| InChIKey | WNECTXUWVUWMNM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-methylbenzo[h]isoquinoline;1-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylbenzo[h]isoquinoline;1-methylindazole?
The IUPAC name of 1-methylbenzo[h]isoquinoline;1-methylindazole (CID 143194474) is 1-methylbenzo[h]isoquinoline;1-methylindazole.
What is the SMILES notation for 1-methylbenzo[h]isoquinoline;1-methylindazole?
The canonical SMILES for 1-methylbenzo[h]isoquinoline;1-methylindazole is Cc1nccc2ccc3ccccc3c12.Cn1ncc2ccccc21.
What is the InChIKey of 1-methylbenzo[h]isoquinoline;1-methylindazole?
The InChIKey is WNECTXUWVUWMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C8H8N2/c1-10-14-12(8-9-15-10)7-6-11-4-2-3-5-13(11)14;1-10-8-5-3-2-4-7(8)6-9-10/h2-9H,1H3;2-6H,1H3.
What are the key properties of 1-methylbenzo[h]isoquinoline;1-methylindazole?
1-methylbenzo[h]isoquinoline;1-methylindazole has a molecular weight of 325.42 g/mol, XLogP of 5.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylbenzo[h]isoquinoline;1-methylindazole is sourced from PubChem (CID 143194474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).